C18H24N4O5 — CID 139191786
ethyl (2S,3S,3aR,4S)-2-[(E)-carbamoyldiazenyl]-2-methyl-4-phenylmethoxy-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-3-carboxylate (PubChem CID 139191786) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is ethyl (2S,3S,3aR,4S)-2-[(E)-carbamoyldiazenyl]-2-methyl-4-phenylmethoxy-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-3-carboxylate.
| Compound Name | ethyl (2S,3S,3aR,4S)-2-[(E)-carbamoyldiazenyl]-2-methyl-4-phenylmethoxy-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 139191786 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | ethyl (2S,3S,3aR,4S)-2-[(E)-carbamoyldiazenyl]-2-methyl-4-phenylmethoxy-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2[C@@H](OCc3ccccc3)CCN2O[C@]1(C)/N=N/C(N)=O |
| InChI | InChI=1S/C18H24N4O5/c1-3-25-16(23)14-15-13(26-11-12-7-5-4-6-8-12)9-10-22(15)27-18(14,2)21-20-17(19)24/h4-8,13-15H,3,9-11H2,1-2H3,(H2,19,24)/b21-20+/t13-,14+,15-,18-/m0/s1 |
| InChIKey | CCGBSCAROKATOP-APQDUSEYSA-N |
| XLogP | 2.02 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|