C16H21NO4 — CID 11781282
methyl (2S,3R,6S,7S,7aS)-3,6,7a-trimethyl-2-phenyl-2,3,6,7-tetrahydro-[1,3]oxazolo[3,2-b][1,2]oxazole-7-carboxylate (PubChem CID 11781282) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl (2S,3R,6S,7S,7aS)-3,6,7a-trimethyl-2-phenyl-2,3,6,7-tetrahydro-[1,3]oxazolo[3,2-b][1,2]oxazole-7-carboxylate.
| Compound Name | methyl (2S,3R,6S,7S,7aS)-3,6,7a-trimethyl-2-phenyl-2,3,6,7-tetrahydro-[1,3]oxazolo[3,2-b][1,2]oxazole-7-carboxylate |
|---|---|
| PubChem CID | 11781282 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | methyl (2S,3R,6S,7S,7aS)-3,6,7a-trimethyl-2-phenyl-2,3,6,7-tetrahydro-[1,3]oxazolo[3,2-b][1,2]oxazole-7-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C)ON2[C@H](C)[C@H](c3ccccc3)O[C@@]12C |
| InChI | InChI=1S/C16H21NO4/c1-10-14(12-8-6-5-7-9-12)20-16(3)13(15(18)19-4)11(2)21-17(10)16/h5-11,13-14H,1-4H3/t10-,11+,13-,14-,16+/m1/s1 |
| InChIKey | KTYNVUZQSZZVBS-JYCXNCNHSA-N |
| XLogP | 2.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |