C17H19NO5 — CID 11461270
4-O-[(2R,3aR,4R)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-yl] 1-O-methyl (Z)-but-2-enedioate (PubChem CID 11461270) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is 4-O-[(2R,3aR,4R)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-yl] 1-O-methyl (Z)-but-2-enedioate.
| Compound Name | 4-O-[(2R,3aR,4R)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-yl] 1-O-methyl (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 11461270 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 4-O-[(2R,3aR,4R)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-yl] 1-O-methyl (Z)-but-2-enedioate |
| SMILES | COC(=O)/C=C\C(=O)O[C@@H]1CCN2O[C@@H](c3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C17H19NO5/c1-21-16(19)7-8-17(20)22-14-9-10-18-13(14)11-15(23-18)12-5-3-2-4-6-12/h2-8,13-15H,9-11H2,1H3/b8-7-/t13-,14-,15-/m1/s1 |
| InChIKey | YMUSNESUDDFVPX-MLQDSIPVSA-N |
| XLogP | 1.78 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|