C13H17NO2 — CID 15429872
(3R,3aS,6S,6aR)-1,6-dimethyl-3-phenyl-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazole (PubChem CID 15429872) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (3R,3aS,6S,6aR)-1,6-dimethyl-3-phenyl-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazole.
| Compound Name | (3R,3aS,6S,6aR)-1,6-dimethyl-3-phenyl-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 15429872 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (3R,3aS,6S,6aR)-1,6-dimethyl-3-phenyl-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazole |
| SMILES | C[C@@H]1OC[C@@H]2[C@H]1N(C)O[C@H]2c1ccccc1 |
| InChI | InChI=1S/C13H17NO2/c1-9-12-11(8-15-9)13(16-14(12)2)10-6-4-3-5-7-10/h3-7,9,11-13H,8H2,1-2H3/t9-,11+,12-,13-/m0/s1 |
| InChIKey | PQRJUQIHDKFECJ-RYDUCSDGSA-N |
| XLogP | 2.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |