C12H15NO2 — CID 12034806
(2R,3aR,4S)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-ol (PubChem CID 12034806) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (2R,3aR,4S)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-ol.
| Compound Name | (2R,3aR,4S)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-ol |
|---|---|
| PubChem CID | 12034806 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (2R,3aR,4S)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-ol |
| SMILES | O[C@H]1CCN2O[C@@H](c3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C12H15NO2/c14-11-6-7-13-10(11)8-12(15-13)9-4-2-1-3-5-9/h1-5,10-12,14H,6-8H2/t10-,11+,12-/m1/s1 |
| InChIKey | OUUFHCVNKLWBNS-GRYCIOLGSA-N |
| XLogP | 1.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |