C33H38N4O7 — CID 177413191
ethyl (2S,3S,3aR,4R,5R,6R)-2-[(E)-carbamoyldiazenyl]-2-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-3-carboxylate (PubChem CID 177413191) has the molecular formula C33H38N4O7 and a molecular weight of 602.69 g/mol. Its IUPAC name is ethyl (2S,3S,3aR,4R,5R,6R)-2-[(E)-carbamoyldiazenyl]-2-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-3-carboxylate.
| Compound Name | ethyl (2S,3S,3aR,4R,5R,6R)-2-[(E)-carbamoyldiazenyl]-2-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 177413191 |
| Molecular Formula | C33H38N4O7 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | ethyl (2S,3S,3aR,4R,5R,6R)-2-[(E)-carbamoyldiazenyl]-2-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)N2O[C@]1(C)/N=N/C(N)=O |
| InChI | InChI=1S/C33H38N4O7/c1-3-41-31(38)27-28-30(43-21-25-17-11-6-12-18-25)29(42-20-24-15-9-5-10-16-24)26(22-40-19-23-13-7-4-8-14-23)37(28)44-33(27,2)36-35-32(34)39/h4-18,26-30H,3,19-22H2,1-2H3,(H2,34,39)/b36-35+/t26-,27-,28-,29-,30-,33+/m1/s1 |
| InChIKey | OPKOPPYMDGPVGR-IRPOAQRRSA-N |
| XLogP | 4.80 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|