C33H39NO6 — CID 56931807
tert-butyl (2S,3aS,4S,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate (PubChem CID 56931807) has the molecular formula C33H39NO6 and a molecular weight of 545.68 g/mol. Its IUPAC name is tert-butyl (2S,3aS,4S,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate.
| Compound Name | tert-butyl (2S,3aS,4S,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate |
|---|---|
| PubChem CID | 56931807 |
| Molecular Formula | C33H39NO6 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | tert-butyl (2S,3aS,4S,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@H]2[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)N2O1 |
| InChI | InChI=1S/C33H39NO6/c1-33(2,3)39-32(35)29-19-27-30(37-21-25-15-9-5-10-16-25)31(38-22-26-17-11-6-12-18-26)28(34(27)40-29)23-36-20-24-13-7-4-8-14-24/h4-18,27-31H,19-23H2,1-3H3/t27-,28+,29-,30-,31+/m0/s1 |
| InChIKey | LYNQHTBQOPGCRH-GKFQJYPJSA-N |
| XLogP | 5.47 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |