C10H15F3O7S — CID 10936602
methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethylsulfonyloxy)propanoate (PubChem CID 10936602) has the molecular formula C10H15F3O7S and a molecular weight of 336.28 g/mol. Its IUPAC name is methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethylsulfonyloxy)propanoate.
| Compound Name | methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethylsulfonyloxy)propanoate |
|---|---|
| PubChem CID | 10936602 |
| Molecular Formula | C10H15F3O7S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | methyl (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethylsulfonyloxy)propanoate |
| SMILES | COC(=O)[C@H](C[C@H]1COC(C)(C)O1)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O7S/c1-9(2)18-5-6(19-9)4-7(8(14)17-3)20-21(15,16)10(11,12)13/h6-7H,4-5H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | BTWUOICANPXTIO-BQBZGAKWSA-N |
| XLogP | 0.94 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|