C9H11F3O7S — CID 169143653
[(3aR,7S,7aR)-2,2-dimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate (PubChem CID 169143653) has the molecular formula C9H11F3O7S and a molecular weight of 320.24 g/mol. Its IUPAC name is [(3aR,7S,7aR)-2,2-dimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,7S,7aR)-2,2-dimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 169143653 |
| Molecular Formula | C9H11F3O7S |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | [(3aR,7S,7aR)-2,2-dimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@H]2[C@H](OS(=O)(=O)C(F)(F)F)C(=O)OC[C@H]2O1 |
| InChI | InChI=1S/C9H11F3O7S/c1-8(2)17-4-3-16-7(13)6(5(4)18-8)19-20(14,15)9(10,11)12/h4-6H,3H2,1-2H3/t4-,5-,6+/m1/s1 |
| InChIKey | CPSWVTCAPJMFEV-PBXRRBTRSA-N |
| XLogP | 0.30 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|