C9H11F3O7S — CID 100930867
[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate (PubChem CID 100930867) has the molecular formula C9H11F3O7S and a molecular weight of 320.24 g/mol. Its IUPAC name is [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 100930867 |
| Molecular Formula | C9H11F3O7S |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@@H]2[C@@H](COS(=O)(=O)C(F)(F)F)OC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C9H11F3O7S/c1-8(2)18-5-4(17-7(13)6(5)19-8)3-16-20(14,15)9(10,11)12/h4-6H,3H2,1-2H3/t4-,5-,6-/m1/s1 |
| InChIKey | HTNZQACLUZADOP-HSUXUTPPSA-N |
| XLogP | 0.30 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|