C11H13F2O9S- — CID 140639454
2-[(2,2,3a-trimethyl-4-oxo-6,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl)methoxy]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 140639454) has the molecular formula C11H13F2O9S- and a molecular weight of 359.28 g/mol. Its IUPAC name is 2-[(2,2,3a-trimethyl-4-oxo-6,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl)methoxy]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[(2,2,3a-trimethyl-4-oxo-6,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl)methoxy]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 140639454 |
| Molecular Formula | C11H13F2O9S- |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 2-[(2,2,3a-trimethyl-4-oxo-6,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl)methoxy]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | CC1(C)OC2C(COC(=O)C(F)(F)S(=O)(=O)[O-])OC(=O)C2(C)O1 |
| InChI | InChI=1S/C11H14F2O9S/c1-9(2)21-6-5(20-7(14)10(6,3)22-9)4-19-8(15)11(12,13)23(16,17)18/h5-6H,4H2,1-3H3,(H,16,17,18)/p-1 |
| InChIKey | DCKSMLCBXDZFBH-UHFFFAOYSA-M |
| XLogP | -0.50 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|