C12H17F3O9S — CID 51357750
methyl (3aR,5S,6R,6aR)-6-methoxy-2,2-dimethyl-5-(trifluoromethylsulfonyloxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carboxylate (PubChem CID 51357750) has the molecular formula C12H17F3O9S and a molecular weight of 394.32 g/mol. Its IUPAC name is methyl (3aR,5S,6R,6aR)-6-methoxy-2,2-dimethyl-5-(trifluoromethylsulfonyloxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carboxylate.
| Compound Name | methyl (3aR,5S,6R,6aR)-6-methoxy-2,2-dimethyl-5-(trifluoromethylsulfonyloxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carboxylate |
|---|---|
| PubChem CID | 51357750 |
| Molecular Formula | C12H17F3O9S |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | methyl (3aR,5S,6R,6aR)-6-methoxy-2,2-dimethyl-5-(trifluoromethylsulfonyloxymethyl)-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carboxylate |
| SMILES | COC(=O)[C@@]1(COS(=O)(=O)C(F)(F)F)O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C12H17F3O9S/c1-10(2)22-6-7(19-3)11(9(16)20-4,24-8(6)23-10)5-21-25(17,18)12(13,14)15/h6-8H,5H2,1-4H3/t6-,7-,8+,11+/m1/s1 |
| InChIKey | DHSXTGLREYGYDB-LEQIOUOKSA-N |
| XLogP | 0.29 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|