C10H13F3O7S — CID 11759421
[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2,2,2-trifluoroethanesulfonate (PubChem CID 11759421) has the molecular formula C10H13F3O7S and a molecular weight of 334.27 g/mol. Its IUPAC name is [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2,2,2-trifluoroethanesulfonate.
| Compound Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 11759421 |
| Molecular Formula | C10H13F3O7S |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2,2,2-trifluoroethanesulfonate |
| SMILES | CC1(C)O[C@@H]2[C@@H](COS(=O)(=O)CC(F)(F)F)OC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C10H13F3O7S/c1-9(2)19-6-5(18-8(14)7(6)20-9)3-17-21(15,16)4-10(11,12)13/h5-7H,3-4H2,1-2H3/t5-,6-,7-/m1/s1 |
| InChIKey | XOBVWCCZEMZYID-FSDSQADBSA-N |
| XLogP | 0.34 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|