C20H25N5O4 — CID 109367610
4-[6-[2-(4-methoxyphenoxy)ethylamino]-2-methylpyrimidine-4-carbonyl]piperazine-1-carbaldehyde (PubChem CID 109367610) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-[6-[2-(4-methoxyphenoxy)ethylamino]-2-methylpyrimidine-4-carbonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[6-[2-(4-methoxyphenoxy)ethylamino]-2-methylpyrimidine-4-carbonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 109367610 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 4-[6-[2-(4-methoxyphenoxy)ethylamino]-2-methylpyrimidine-4-carbonyl]piperazine-1-carbaldehyde |
| SMILES | COc1ccc(OCCNc2cc(C(=O)N3CCN(C=O)CC3)nc(C)n2)cc1 |
| InChI | InChI=1S/C20H25N5O4/c1-15-22-18(20(27)25-10-8-24(14-26)9-11-25)13-19(23-15)21-7-12-29-17-5-3-16(28-2)4-6-17/h3-6,13-14H,7-12H2,1-2H3,(H,21,22,23) |
| InChIKey | AOXOXMNURKHHLJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|