C19H19N4O4+ — CID 10937432
ethyl 1-(benzoylcarbamoylamino)-3-methylbenzimidazol-3-ium-2-carboxylate (PubChem CID 10937432) has the molecular formula C19H19N4O4+ and a molecular weight of 367.39 g/mol. Its IUPAC name is ethyl 1-(benzoylcarbamoylamino)-3-methylbenzimidazol-3-ium-2-carboxylate.
| Compound Name | ethyl 1-(benzoylcarbamoylamino)-3-methylbenzimidazol-3-ium-2-carboxylate |
|---|---|
| PubChem CID | 10937432 |
| Molecular Formula | C19H19N4O4+ |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | ethyl 1-(benzoylcarbamoylamino)-3-methylbenzimidazol-3-ium-2-carboxylate |
| SMILES | CCOC(=O)c1n(NC(=O)NC(=O)c2ccccc2)c2ccccc2[n+]1C |
| InChI | InChI=1S/C19H18N4O4/c1-3-27-18(25)17-22(2)14-11-7-8-12-15(14)23(17)21-19(26)20-16(24)13-9-5-4-6-10-13/h4-12H,3H2,1-2H3,(H-,20,21,24,25,26)/p+1 |
| InChIKey | ASYVDJDZYPAUHR-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|