C16H15N3O5S — CID 10594735
ethyl 6-(benzoylcarbamoylamino)-2-methyl-4-sulfanylidene-1,3-oxazine-5-carboxylate (PubChem CID 10594735) has the molecular formula C16H15N3O5S and a molecular weight of 361.38 g/mol. Its IUPAC name is ethyl 6-(benzoylcarbamoylamino)-2-methyl-4-sulfanylidene-1,3-oxazine-5-carboxylate.
| Compound Name | ethyl 6-(benzoylcarbamoylamino)-2-methyl-4-sulfanylidene-1,3-oxazine-5-carboxylate |
|---|---|
| PubChem CID | 10594735 |
| Molecular Formula | C16H15N3O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | ethyl 6-(benzoylcarbamoylamino)-2-methyl-4-sulfanylidene-1,3-oxazine-5-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)NC(=O)c2ccccc2)oc(C)nc1=S |
| InChI | InChI=1S/C16H15N3O5S/c1-3-23-15(21)11-13(24-9(2)17-14(11)25)19-16(22)18-12(20)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | WQNNXTCGVPZRGB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|