C18H33F3N6O — CID 109376695
1-[3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 109376695) has the molecular formula C18H33F3N6O and a molecular weight of 406.50 g/mol. Its IUPAC name is 1-[3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 109376695 |
| Molecular Formula | C18H33F3N6O |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 1-[3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | C/N=C(\NCCCN1CCCC(C(N)=O)C1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H33F3N6O/c1-14(18(19,20)21)26-9-11-27(12-10-26)17(23-2)24-6-4-8-25-7-3-5-15(13-25)16(22)28/h14-15H,3-13H2,1-2H3,(H2,22,28)(H,23,24) |
| InChIKey | OKYZVEAROLJPQT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 77.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|