C25H34OSi — CID 10937740
6-[[tert-butyl(diphenyl)silyl]methyl]-5-methylhept-6-en-3-one (PubChem CID 10937740) has the molecular formula C25H34OSi and a molecular weight of 378.63 g/mol. Its IUPAC name is 6-[[tert-butyl(diphenyl)silyl]methyl]-5-methylhept-6-en-3-one.
| Compound Name | 6-[[tert-butyl(diphenyl)silyl]methyl]-5-methylhept-6-en-3-one |
|---|---|
| PubChem CID | 10937740 |
| Molecular Formula | C25H34OSi |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 6-[[tert-butyl(diphenyl)silyl]methyl]-5-methylhept-6-en-3-one |
| SMILES | C=C(C[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)CC(=O)CC |
| InChI | InChI=1S/C25H34OSi/c1-7-22(26)18-20(2)21(3)19-27(25(4,5)6,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,20H,3,7,18-19H2,1-2,4-6H3 |
| InChIKey | ZJRMEYHUCOTKGN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|