C15H27F3IN5O — CID 109377616
N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide (PubChem CID 109377616) has the molecular formula C15H27F3IN5O and a molecular weight of 477.31 g/mol. Its IUPAC name is N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 109377616 |
| Molecular Formula | C15H27F3IN5O |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)C1CC1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C15H26F3N5O.HI/c1-11(15(16,17)18)22-7-9-23(10-8-22)14(19-2)21-6-5-20-13(24)12-3-4-12;/h11-12H,3-10H2,1-2H3,(H,19,21)(H,20,24);1H |
| InChIKey | HCFHZFVSRKCRBP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|