C20H38F3IN6O — CID 109377762
1-[3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide (PubChem CID 109377762) has the molecular formula C20H38F3IN6O and a molecular weight of 562.46 g/mol. Its IUPAC name is 1-[3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109377762 |
| Molecular Formula | C20H38F3IN6O |
| Molecular Weight | 562.46 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 1-[3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCC1C(=O)N(C)C)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C20H37F3N6O.HI/c1-5-24-19(29-14-12-27(13-15-29)16(2)20(21,22)23)25-9-7-11-28-10-6-8-17(28)18(30)26(3)4;/h16-17H,5-15H2,1-4H3,(H,24,25);1H |
| InChIKey | IAMRXPNYBCWNCL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|