C14H25N3O — CID 109377857
N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]azepane-1-carboximidamide (PubChem CID 109377857) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]azepane-1-carboximidamide.
| Compound Name | N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]azepane-1-carboximidamide |
|---|---|
| PubChem CID | 109377857 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | N'-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]azepane-1-carboximidamide |
| SMILES | N/C(=N\CCC1=CCOCC1)N1CCCCCC1 |
| InChI | InChI=1S/C14H25N3O/c15-14(17-9-3-1-2-4-10-17)16-8-5-13-6-11-18-12-7-13/h6H,1-5,7-12H2,(H2,15,16) |
| InChIKey | HABBJNDHLJIDSL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|