C18H27F3N4O2 — CID 109378347
N-ethyl-N'-[(2-hydroxy-5-methoxyphenyl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378347) has the molecular formula C18H27F3N4O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is N-ethyl-N'-[(2-hydroxy-5-methoxyphenyl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(2-hydroxy-5-methoxyphenyl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378347 |
| Molecular Formula | C18H27F3N4O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | N-ethyl-N'-[(2-hydroxy-5-methoxyphenyl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cc(OC)ccc1O)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H27F3N4O2/c1-4-22-17(23-12-14-11-15(27-3)5-6-16(14)26)25-9-7-24(8-10-25)13(2)18(19,20)21/h5-6,11,13,26H,4,7-10,12H2,1-3H3,(H,22,23) |
| InChIKey | VGTWEHCTNIFGQI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|