C20H25F3N2O2 — CID 142835645
benzene;(3S)-N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperidin-3-amine (PubChem CID 142835645) has the molecular formula C20H25F3N2O2 and a molecular weight of 382.43 g/mol. Its IUPAC name is benzene;(3S)-N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperidin-3-amine.
| Compound Name | benzene;(3S)-N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 142835645 |
| Molecular Formula | C20H25F3N2O2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | benzene;(3S)-N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperidin-3-amine |
| SMILES | COc1ccc(OC(F)(F)F)cc1CN[C@H]1CCCNC1.c1ccccc1 |
| InChI | InChI=1S/C14H19F3N2O2.C6H6/c1-20-13-5-4-12(21-14(15,16)17)7-10(13)8-19-11-3-2-6-18-9-11;1-2-4-6-5-3-1/h4-5,7,11,18-19H,2-3,6,8-9H2,1H3;1-6H/t11-;/m0./s1 |
| InChIKey | CHQZTSOBDDBIBI-MERQFXBCSA-N |
| XLogP | 4.12 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |