C20H19F3N2O4 — CID 154572821
(5R,6S)-5-[[2-methoxy-5-(trifluoromethoxy)phenyl]methylamino]-6-phenylpiperidine-2,4-dione (PubChem CID 154572821) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is (5R,6S)-5-[[2-methoxy-5-(trifluoromethoxy)phenyl]methylamino]-6-phenylpiperidine-2,4-dione.
| Compound Name | (5R,6S)-5-[[2-methoxy-5-(trifluoromethoxy)phenyl]methylamino]-6-phenylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 154572821 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (5R,6S)-5-[[2-methoxy-5-(trifluoromethoxy)phenyl]methylamino]-6-phenylpiperidine-2,4-dione |
| SMILES | COc1ccc(OC(F)(F)F)cc1CN[C@H]1C(=O)CC(=O)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H19F3N2O4/c1-28-16-8-7-14(29-20(21,22)23)9-13(16)11-24-19-15(26)10-17(27)25-18(19)12-5-3-2-4-6-12/h2-9,18-19,24H,10-11H2,1H3,(H,25,27)/t18-,19-/m0/s1 |
| InChIKey | SQBCTTVGKCSVTP-OALUTQOASA-N |
| XLogP | 2.88 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|