C22H24F3NO2 — CID 139699820
N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]-3-phenylbicyclo[2.2.1]heptan-2-amine (PubChem CID 139699820) has the molecular formula C22H24F3NO2 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]-3-phenylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]-3-phenylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 139699820 |
| Molecular Formula | C22H24F3NO2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]-3-phenylbicyclo[2.2.1]heptan-2-amine |
| SMILES | COc1ccc(OC(F)(F)F)cc1CNC1C2CCC(C2)C1c1ccccc1 |
| InChI | InChI=1S/C22H24F3NO2/c1-27-19-10-9-18(28-22(23,24)25)12-17(19)13-26-21-16-8-7-15(11-16)20(21)14-5-3-2-4-6-14/h2-6,9-10,12,15-16,20-21,26H,7-8,11,13H2,1H3 |
| InChIKey | FCLIRXOCPHBADJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |