C21H38F3N5O2 — CID 109379460
tert-butyl 4-[[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate (PubChem CID 109379460) has the molecular formula C21H38F3N5O2 and a molecular weight of 449.56 g/mol. Its IUPAC name is tert-butyl 4-[[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109379460 |
| Molecular Formula | C21H38F3N5O2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | tert-butyl 4-[[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CC1CCN(C(=O)OC(C)(C)C)CC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H38F3N5O2/c1-6-25-18(28-13-11-27(12-14-28)16(2)21(22,23)24)26-15-17-7-9-29(10-8-17)19(30)31-20(3,4)5/h16-17H,6-15H2,1-5H3,(H,25,26) |
| InChIKey | UXXXXPQRHVWQCG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|