C17H30F3N5O2 — CID 109376553
ethyl N-[1-cyclopropyl-2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]carbamate (PubChem CID 109376553) has the molecular formula C17H30F3N5O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is ethyl N-[1-cyclopropyl-2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[1-cyclopropyl-2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 109376553 |
| Molecular Formula | C17H30F3N5O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | ethyl N-[1-cyclopropyl-2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NC(CN/C(=N\C)N1CCN(C(C)C(F)(F)F)CC1)C1CC1 |
| InChI | InChI=1S/C17H30F3N5O2/c1-4-27-16(26)23-14(13-5-6-13)11-22-15(21-3)25-9-7-24(8-10-25)12(2)17(18,19)20/h12-14H,4-11H2,1-3H3,(H,21,22)(H,23,26) |
| InChIKey | LLHPDMSXYUDEAP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|