C11H21N3O3S — CID 109379590
N-(4-hydroxy-3-methylbutan-2-yl)-1-propan-2-ylimidazole-4-sulfonamide (PubChem CID 109379590) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylbutan-2-yl)-1-propan-2-ylimidazole-4-sulfonamide.
| Compound Name | N-(4-hydroxy-3-methylbutan-2-yl)-1-propan-2-ylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 109379590 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(4-hydroxy-3-methylbutan-2-yl)-1-propan-2-ylimidazole-4-sulfonamide |
| SMILES | CC(CO)C(C)NS(=O)(=O)c1cn(C(C)C)cn1 |
| InChI | InChI=1S/C11H21N3O3S/c1-8(2)14-5-11(12-7-14)18(16,17)13-10(4)9(3)6-15/h5,7-10,13,15H,6H2,1-4H3 |
| InChIKey | PQCWBYCILIBUEN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |