C11H21N3O2S2 — CID 97326472
N-[(2S)-2-methyl-3-methylsulfanylpropyl]-1-propan-2-ylimidazole-4-sulfonamide (PubChem CID 97326472) has the molecular formula C11H21N3O2S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[(2S)-2-methyl-3-methylsulfanylpropyl]-1-propan-2-ylimidazole-4-sulfonamide.
| Compound Name | N-[(2S)-2-methyl-3-methylsulfanylpropyl]-1-propan-2-ylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 97326472 |
| Molecular Formula | C11H21N3O2S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[(2S)-2-methyl-3-methylsulfanylpropyl]-1-propan-2-ylimidazole-4-sulfonamide |
| SMILES | CSC[C@@H](C)CNS(=O)(=O)c1cn(C(C)C)cn1 |
| InChI | InChI=1S/C11H21N3O2S2/c1-9(2)14-6-11(12-8-14)18(15,16)13-5-10(3)7-17-4/h6,8-10,13H,5,7H2,1-4H3/t10-/m0/s1 |
| InChIKey | WZOSVTLNDLCSBK-JTQLQIEISA-N |
| XLogP | 1.74 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |