C16H24Cl2N2O2 — CID 109379748
1-[3-[(2,5-dichloro-4-methoxyphenyl)methylamino]propyl]piperidin-4-ol (PubChem CID 109379748) has the molecular formula C16H24Cl2N2O2 and a molecular weight of 347.29 g/mol. Its IUPAC name is 1-[3-[(2,5-dichloro-4-methoxyphenyl)methylamino]propyl]piperidin-4-ol.
| Compound Name | 1-[3-[(2,5-dichloro-4-methoxyphenyl)methylamino]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 109379748 |
| Molecular Formula | C16H24Cl2N2O2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-[3-[(2,5-dichloro-4-methoxyphenyl)methylamino]propyl]piperidin-4-ol |
| SMILES | COc1cc(Cl)c(CNCCCN2CCC(O)CC2)cc1Cl |
| InChI | InChI=1S/C16H24Cl2N2O2/c1-22-16-10-14(17)12(9-15(16)18)11-19-5-2-6-20-7-3-13(21)4-8-20/h9-10,13,19,21H,2-8,11H2,1H3 |
| InChIKey | NCGHZKXZPPOUPD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|