C13H18N2O3 — CID 109379967
2-[[5-(3,6-dihydro-2H-pyran-5-ylmethylamino)-2-pyridinyl]oxy]ethanol (PubChem CID 109379967) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-[[5-(3,6-dihydro-2H-pyran-5-ylmethylamino)-2-pyridinyl]oxy]ethanol.
| Compound Name | 2-[[5-(3,6-dihydro-2H-pyran-5-ylmethylamino)-2-pyridinyl]oxy]ethanol |
|---|---|
| PubChem CID | 109379967 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-[[5-(3,6-dihydro-2H-pyran-5-ylmethylamino)-2-pyridinyl]oxy]ethanol |
| SMILES | OCCOc1ccc(NCC2=CCCOC2)cn1 |
| InChI | InChI=1S/C13H18N2O3/c16-5-7-18-13-4-3-12(9-15-13)14-8-11-2-1-6-17-10-11/h2-4,9,14,16H,1,5-8,10H2 |
| InChIKey | FDUXKKPIXCWBTQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|