C13H28IN3O3 — CID 109382371
3-[2-(2-methoxyethoxy)ethyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109382371) has the molecular formula C13H28IN3O3 and a molecular weight of 401.29 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)ethyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[2-(2-methoxyethoxy)ethyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109382371 |
| Molecular Formula | C13H28IN3O3 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)ethyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOCCOC)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C13H27N3O3.HI/c1-14-13(15-5-7-18-9-8-17-3)16(2)10-12-4-6-19-11-12;/h12H,4-11H2,1-3H3,(H,14,15);1H |
| InChIKey | UWTVXGMLPXQBPB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|