C19H34N4O3S2 — CID 109384228
2-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109384228) has the molecular formula C19H34N4O3S2 and a molecular weight of 430.64 g/mol. Its IUPAC name is 2-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 2-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109384228 |
| Molecular Formula | C19H34N4O3S2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 2-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CCc1ccc(S(=O)(=O)N(CC)CC)s1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C19H34N4O3S2/c1-5-20-19(22(4)14-16-11-13-26-15-16)21-12-10-17-8-9-18(27-17)28(24,25)23(6-2)7-3/h8-9,16H,5-7,10-15H2,1-4H3,(H,20,21) |
| InChIKey | NRDVEQDHENGWBO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|