C22H34O3S2 — CID 10938501
[(1R,2E,4R,7S,8R,9R,10R)-9,10-dihydroxy-1,4,8-trimethyl-12-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradeca-2,11-dienyl]sulfanyl-methylsulfanylmethanone (PubChem CID 10938501) has the molecular formula C22H34O3S2 and a molecular weight of 410.65 g/mol. Its IUPAC name is [(1R,2E,4R,7S,8R,9R,10R)-9,10-dihydroxy-1,4,8-trimethyl-12-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradeca-2,11-dienyl]sulfanyl-methylsulfanylmethanone.
| Compound Name | [(1R,2E,4R,7S,8R,9R,10R)-9,10-dihydroxy-1,4,8-trimethyl-12-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradeca-2,11-dienyl]sulfanyl-methylsulfanylmethanone |
|---|---|
| PubChem CID | 10938501 |
| Molecular Formula | C22H34O3S2 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [(1R,2E,4R,7S,8R,9R,10R)-9,10-dihydroxy-1,4,8-trimethyl-12-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradeca-2,11-dienyl]sulfanyl-methylsulfanylmethanone |
| SMILES | CSC(=O)S[C@]1(C)CC[C@@H]2/C1=C\[C@@]1(C)CCC(C(C)C)=C1[C@@H](O)[C@H](O)[C@@H]2C |
| InChI | InChI=1S/C22H34O3S2/c1-12(2)14-7-9-21(4)11-16-15(13(3)18(23)19(24)17(14)21)8-10-22(16,5)27-20(25)26-6/h11-13,15,18-19,23-24H,7-10H2,1-6H3/b16-11+/t13-,15+,18-,19-,21-,22-/m1/s1 |
| InChIKey | XZJKRVPZCYCBPN-XAMPOEPNSA-N |
| XLogP | 5.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|