C30H48O2 — CID 123199772
5a,5b,8,11a-tetramethyl-3a-(oxiran-2-yl)-1-propan-2-yl-3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a-tetradecahydro-2H-cyclopenta[a]chrysen-9-ol (PubChem CID 123199772) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is 5a,5b,8,11a-tetramethyl-3a-(oxiran-2-yl)-1-propan-2-yl-3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a-tetradecahydro-2H-cyclopenta[a]chrysen-9-ol.
| Compound Name | 5a,5b,8,11a-tetramethyl-3a-(oxiran-2-yl)-1-propan-2-yl-3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a-tetradecahydro-2H-cyclopenta[a]chrysen-9-ol |
|---|---|
| PubChem CID | 123199772 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | 5a,5b,8,11a-tetramethyl-3a-(oxiran-2-yl)-1-propan-2-yl-3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a-tetradecahydro-2H-cyclopenta[a]chrysen-9-ol |
| SMILES | CC(C)C1=C2C3CCC4C5(C)CCC(O)C(C)C5CCC4(C)C3(C)CCC2(C2CO2)CC1 |
| InChI | InChI=1S/C30H48O2/c1-18(2)20-9-14-30(25-17-32-25)16-15-28(5)22(26(20)30)7-8-24-27(4)12-11-23(31)19(3)21(27)10-13-29(24,28)6/h18-19,21-25,31H,7-17H2,1-6H3 |
| InChIKey | LBFOPEAHHHOBNG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|