C32H55NO — CID 71079404
1-[(3aS,5aR,5bR,7aS,9S,11aS,11bR,13aS)-5a,5b,8,8,9,11a-hexamethyl-1-propan-2-yl-2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-3a-yl]-2-aminoethanol (PubChem CID 71079404) has the molecular formula C32H55NO and a molecular weight of 469.80 g/mol. Its IUPAC name is 1-[(3aS,5aR,5bR,7aS,9S,11aS,11bR,13aS)-5a,5b,8,8,9,11a-hexamethyl-1-propan-2-yl-2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-3a-yl]-2-aminoethanol.
| Compound Name | 1-[(3aS,5aR,5bR,7aS,9S,11aS,11bR,13aS)-5a,5b,8,8,9,11a-hexamethyl-1-propan-2-yl-2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-3a-yl]-2-aminoethanol |
|---|---|
| PubChem CID | 71079404 |
| Molecular Formula | C32H55NO |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 469.43 |
| IUPAC Name | 1-[(3aS,5aR,5bR,7aS,9S,11aS,11bR,13aS)-5a,5b,8,8,9,11a-hexamethyl-1-propan-2-yl-2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-3a-yl]-2-aminoethanol |
| SMILES | CC(C)C1=C2[C@H]3CC[C@@H]4[C@@]5(C)CC[C@H](C)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@]2(C(O)CN)CC1 |
| InChI | InChI=1S/C32H55NO/c1-20(2)22-12-16-32(26(34)19-33)18-17-30(7)23(27(22)32)9-10-25-29(6)14-11-21(3)28(4,5)24(29)13-15-31(25,30)8/h20-21,23-26,34H,9-19,33H2,1-8H3/t21-,23+,24-,25+,26?,29-,30+,31+,32+/m0/s1 |
| InChIKey | RODWXVVWYQCAGL-AKZZDFKISA-N |
| XLogP | 7.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|