C29H50O2 — CID 162953157
11-(hydroxymethyl)-4,6a,6b,8a,11,14b-hexamethyl-2,3,4,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydro-1H-picen-3-ol (PubChem CID 162953157) has the molecular formula C29H50O2 and a molecular weight of 430.72 g/mol. Its IUPAC name is 11-(hydroxymethyl)-4,6a,6b,8a,11,14b-hexamethyl-2,3,4,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydro-1H-picen-3-ol.
| Compound Name | 11-(hydroxymethyl)-4,6a,6b,8a,11,14b-hexamethyl-2,3,4,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydro-1H-picen-3-ol |
|---|---|
| PubChem CID | 162953157 |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | 11-(hydroxymethyl)-4,6a,6b,8a,11,14b-hexamethyl-2,3,4,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydro-1H-picen-3-ol |
| SMILES | CC1C(O)CCC2(C)C1CCC1C2CCC2(C)C3CC(C)(CO)CCC3(C)CCC12C |
| InChI | InChI=1S/C29H50O2/c1-19-20-7-8-22-21(27(20,4)11-10-23(19)31)9-12-29(6)24-17-25(2,18-30)13-14-26(24,3)15-16-28(22,29)5/h19-24,30-31H,7-18H2,1-6H3 |
| InChIKey | PJLARGKEYKAXIH-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |