C28H48O3 — CID 143760767
(5aS)-3a-(hydroxymethyl)-5a,8,11a-trimethyl-1,2,3,4,5,5b,6,7,7a,8,9,10,11,11b,12,13,13a,13b-octadecahydrocyclopenta[a]chrysen-9-ol;prop-2-en-1-ol (PubChem CID 143760767) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is (5aS)-3a-(hydroxymethyl)-5a,8,11a-trimethyl-1,2,3,4,5,5b,6,7,7a,8,9,10,11,11b,12,13,13a,13b-octadecahydrocyclopenta[a]chrysen-9-ol;prop-2-en-1-ol.
| Compound Name | (5aS)-3a-(hydroxymethyl)-5a,8,11a-trimethyl-1,2,3,4,5,5b,6,7,7a,8,9,10,11,11b,12,13,13a,13b-octadecahydrocyclopenta[a]chrysen-9-ol;prop-2-en-1-ol |
|---|---|
| PubChem CID | 143760767 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | (5aS)-3a-(hydroxymethyl)-5a,8,11a-trimethyl-1,2,3,4,5,5b,6,7,7a,8,9,10,11,11b,12,13,13a,13b-octadecahydrocyclopenta[a]chrysen-9-ol;prop-2-en-1-ol |
| SMILES | C=CCO.CC1C(O)CCC2(C)C1CCC1C2CCC2C3CCCC3(CO)CC[C@]21C |
| InChI | InChI=1S/C25H42O2.C3H6O/c1-16-17-6-7-19-18(23(17,2)12-10-22(16)27)8-9-20-21-5-4-11-25(21,15-26)14-13-24(19,20)3;1-2-3-4/h16-22,26-27H,4-15H2,1-3H3;2,4H,1,3H2/t16?,17?,18?,19?,20?,21?,22?,23?,24-,25?;/m0./s1 |
| InChIKey | VKQJBWROYWJVOH-JFXHMAFSSA-N |
| XLogP | 5.58 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|