C30H55NO — CID 145428746
ethane;prop-1-ene;[(2S)-2,14,18,18-tetramethyl-17-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosan-5-yl]methanol (PubChem CID 145428746) has the molecular formula C30H55NO and a molecular weight of 445.78 g/mol. Its IUPAC name is ethane;prop-1-ene;[(2S)-2,14,18,18-tetramethyl-17-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosan-5-yl]methanol.
| Compound Name | ethane;prop-1-ene;[(2S)-2,14,18,18-tetramethyl-17-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosan-5-yl]methanol |
|---|---|
| PubChem CID | 145428746 |
| Molecular Formula | C30H55NO |
| Molecular Weight | 445.78 g/mol |
| Exact Mass | 445.43 |
| IUPAC Name | ethane;prop-1-ene;[(2S)-2,14,18,18-tetramethyl-17-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosan-5-yl]methanol |
| SMILES | C=CC.CC.CC1(C)NCCC2(C)C3CCC4C5CCCC5(CO)CC[C@@]4(C)C3CCC12 |
| InChI | InChI=1S/C25H43NO.C3H6.C2H6/c1-22(2)21-10-9-17-18(24(21,4)14-15-26-22)7-8-19-20-6-5-11-25(20,16-27)13-12-23(17,19)3;1-3-2;1-2/h17-21,26-27H,5-16H2,1-4H3;3H,1H2,2H3;1-2H3/t17?,18?,19?,20?,21?,23-,24?,25?;;/m0../s1 |
| InChIKey | ZYRJNAACWVSGEH-USNFXOTISA-N |
| XLogP | 7.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.78 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|