C28H49NO2 — CID 144524682
[(5aR,13bR)-5a,5b,8,11a-tetramethyl-9-nitroso-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-3a-yl]methanol;ethane (PubChem CID 144524682) has the molecular formula C28H49NO2 and a molecular weight of 431.71 g/mol. Its IUPAC name is [(5aR,13bR)-5a,5b,8,11a-tetramethyl-9-nitroso-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-3a-yl]methanol;ethane.
| Compound Name | [(5aR,13bR)-5a,5b,8,11a-tetramethyl-9-nitroso-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-3a-yl]methanol;ethane |
|---|---|
| PubChem CID | 144524682 |
| Molecular Formula | C28H49NO2 |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 431.38 |
| IUPAC Name | [(5aR,13bR)-5a,5b,8,11a-tetramethyl-9-nitroso-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-3a-yl]methanol;ethane |
| SMILES | CC.CC1C(N=O)CCC2(C)C1CCC1(C)C2CCC2[C@H]3CCCC3(CO)CC[C@]21C |
| InChI | InChI=1S/C26H43NO2.C2H6/c1-17-18-9-13-25(4)22(23(18,2)12-10-21(17)27-29)8-7-19-20-6-5-11-26(20,16-28)15-14-24(19,25)3;1-2/h17-22,28H,5-16H2,1-4H3;1-2H3/t17?,18?,19?,20-,21?,22?,23?,24-,25?,26?;/m1./s1 |
| InChIKey | VJLAMHILGVUNBL-FTOVMSFNSA-N |
| XLogP | 7.61 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |