C28H46N2O2 — CID 143591407
(NE)-N-[(5b,8,11a-trimethyl-9-nitroso-1,2,3,4,5,5a,6,7,7a,8,9,10,11,11b,12,13,13a,13b-octadecahydrocyclopenta[a]chrysen-3a-yl)methylidene]hydroxylamine;prop-1-ene (PubChem CID 143591407) has the molecular formula C28H46N2O2 and a molecular weight of 442.69 g/mol. Its IUPAC name is (NE)-N-[(5b,8,11a-trimethyl-9-nitroso-1,2,3,4,5,5a,6,7,7a,8,9,10,11,11b,12,13,13a,13b-octadecahydrocyclopenta[a]chrysen-3a-yl)methylidene]hydroxylamine;prop-1-ene.
| Compound Name | (NE)-N-[(5b,8,11a-trimethyl-9-nitroso-1,2,3,4,5,5a,6,7,7a,8,9,10,11,11b,12,13,13a,13b-octadecahydrocyclopenta[a]chrysen-3a-yl)methylidene]hydroxylamine;prop-1-ene |
|---|---|
| PubChem CID | 143591407 |
| Molecular Formula | C28H46N2O2 |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 442.36 |
| IUPAC Name | (NE)-N-[(5b,8,11a-trimethyl-9-nitroso-1,2,3,4,5,5a,6,7,7a,8,9,10,11,11b,12,13,13a,13b-octadecahydrocyclopenta[a]chrysen-3a-yl)methylidene]hydroxylamine;prop-1-ene |
| SMILES | C=CC.CC1C(N=O)CCC2(C)C1CCC1(C)C3CCC4(/C=N/O)CCCC4C3CCC21 |
| InChI | InChI=1S/C25H40N2O2.C3H6/c1-16-18-8-12-24(3)19-9-14-25(15-26-28)11-4-5-20(25)17(19)6-7-22(24)23(18,2)13-10-21(16)27-29;1-3-2/h15-22,28H,4-14H2,1-3H3;3H,1H2,2H3/b26-15+; |
| InChIKey | NWNHILXNNGYOQH-UUXIZDQESA-N |
| XLogP | 7.85 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|