C33H50O — CID 145170721
[3a-(cyclopropylidenemethyl)-5b,8,8,11a-tetramethyl-1,2,3,4,5,5a,6,7,7a,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ylidene]methanone;prop-1-ene (PubChem CID 145170721) has the molecular formula C33H50O and a molecular weight of 462.76 g/mol. Its IUPAC name is [3a-(cyclopropylidenemethyl)-5b,8,8,11a-tetramethyl-1,2,3,4,5,5a,6,7,7a,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ylidene]methanone;prop-1-ene.
| Compound Name | [3a-(cyclopropylidenemethyl)-5b,8,8,11a-tetramethyl-1,2,3,4,5,5a,6,7,7a,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ylidene]methanone;prop-1-ene |
|---|---|
| PubChem CID | 145170721 |
| Molecular Formula | C33H50O |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 462.39 |
| IUPAC Name | [3a-(cyclopropylidenemethyl)-5b,8,8,11a-tetramethyl-1,2,3,4,5,5a,6,7,7a,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ylidene]methanone;prop-1-ene |
| SMILES | C=CC.CC1(C)C(=C=O)CCC2(C)C1CCC1(C)C3CCC4(C=C5CC5)CCCC4C3CCC12 |
| InChI | InChI=1S/C30H44O.C3H6/c1-27(2)21(19-31)11-15-29(4)25(27)13-16-28(3)23-12-17-30(18-20-7-8-20)14-5-6-24(30)22(23)9-10-26(28)29;1-3-2/h18,22-26H,5-17H2,1-4H3;3H,1H2,2H3 |
| InChIKey | NUAAMURUQDMCRZ-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|