C40H63NO4 — CID 145477782
(3a-formyl-5b,8,8,11a-tetramethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-yl) acetate;1-(4-methoxyphenyl)-N-methylmethanamine;prop-1-ene (PubChem CID 145477782) has the molecular formula C40H63NO4 and a molecular weight of 621.95 g/mol. Its IUPAC name is (3a-formyl-5b,8,8,11a-tetramethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-yl) acetate;1-(4-methoxyphenyl)-N-methylmethanamine;prop-1-ene.
| Compound Name | (3a-formyl-5b,8,8,11a-tetramethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-yl) acetate;1-(4-methoxyphenyl)-N-methylmethanamine;prop-1-ene |
|---|---|
| PubChem CID | 145477782 |
| Molecular Formula | C40H63NO4 |
| Molecular Weight | 621.95 g/mol |
| Exact Mass | 621.48 |
| IUPAC Name | (3a-formyl-5b,8,8,11a-tetramethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-yl) acetate;1-(4-methoxyphenyl)-N-methylmethanamine;prop-1-ene |
| SMILES | C=CC.CC(=O)OC1CCC2(C)C(CCC3(C)C4CCC5(C=O)CCCC5C4CCC32)C1(C)C.CNCc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H44O3.C9H13NO.C3H6/c1-18(30)31-24-12-15-27(5)22(25(24,2)3)11-14-26(4)20-10-16-28(17-29)13-6-7-21(28)19(20)8-9-23(26)27;1-10-7-8-3-5-9(11-2)6-4-8;1-3-2/h17,19-24H,6-16H2,1-5H3;3-6,10H,7H2,1-2H3;3H,1H2,2H3 |
| InChIKey | LDZNDLUOKSGETD-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.95 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|