C32H51NO4 — CID 143847178
(3a-formamido-5b,8,8,11a-tetramethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-yl) 3,3-dimethyl-4-oxobutanoate (PubChem CID 143847178) has the molecular formula C32H51NO4 and a molecular weight of 513.76 g/mol. Its IUPAC name is (3a-formamido-5b,8,8,11a-tetramethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-yl) 3,3-dimethyl-4-oxobutanoate.
| Compound Name | (3a-formamido-5b,8,8,11a-tetramethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-yl) 3,3-dimethyl-4-oxobutanoate |
|---|---|
| PubChem CID | 143847178 |
| Molecular Formula | C32H51NO4 |
| Molecular Weight | 513.76 g/mol |
| Exact Mass | 513.38 |
| IUPAC Name | (3a-formamido-5b,8,8,11a-tetramethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-yl) 3,3-dimethyl-4-oxobutanoate |
| SMILES | CC(C)(C=O)CC(=O)OC1CCC2(C)C(CCC3(C)C4CCC5(NC=O)CCCC5C4CCC32)C1(C)C |
| InChI | InChI=1S/C32H51NO4/c1-28(2,19-34)18-27(36)37-26-13-16-31(6)24(29(26,3)4)12-15-30(5)22-11-17-32(33-20-35)14-7-8-23(32)21(22)9-10-25(30)31/h19-26H,7-18H2,1-6H3,(H,33,35) |
| InChIKey | OKMAPRLFRPFOGB-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.76 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|