C41H59NO6 — CID 145477900
4-[[[9-(3,3-dimethyl-4-oxobutanoyl)oxy-1,5b,8,8,11a-pentamethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carbonyl]amino]methyl]benzoic acid (PubChem CID 145477900) has the molecular formula C41H59NO6 and a molecular weight of 661.92 g/mol. Its IUPAC name is 4-[[[9-(3,3-dimethyl-4-oxobutanoyl)oxy-1,5b,8,8,11a-pentamethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[9-(3,3-dimethyl-4-oxobutanoyl)oxy-1,5b,8,8,11a-pentamethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 145477900 |
| Molecular Formula | C41H59NO6 |
| Molecular Weight | 661.92 g/mol |
| Exact Mass | 661.43 |
| IUPAC Name | 4-[[[9-(3,3-dimethyl-4-oxobutanoyl)oxy-1,5b,8,8,11a-pentamethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carbonyl]amino]methyl]benzoic acid |
| SMILES | CC1CCC2(C(=O)NCc3ccc(C(=O)O)cc3)CCC3C(CCC4C3(C)CCC3C(C)(C)C(OC(=O)CC(C)(C)C=O)CCC34C)C12 |
| InChI | InChI=1S/C41H59NO6/c1-25-14-20-41(36(47)42-23-26-8-10-27(11-9-26)35(45)46)21-15-29-28(34(25)41)12-13-31-39(29,6)18-16-30-38(4,5)32(17-19-40(30,31)7)48-33(44)22-37(2,3)24-43/h8-11,24-25,28-32,34H,12-23H2,1-7H3,(H,42,47)(H,45,46) |
| InChIKey | PMZNOPABAUFMBV-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.92 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|