C26H42O2 — CID 144553365
(11aR)-8-ethenyl-5b,8,11a-trimethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a,9-diol (PubChem CID 144553365) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is (11aR)-8-ethenyl-5b,8,11a-trimethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a,9-diol.
| Compound Name | (11aR)-8-ethenyl-5b,8,11a-trimethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a,9-diol |
|---|---|
| PubChem CID | 144553365 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | (11aR)-8-ethenyl-5b,8,11a-trimethyl-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a,9-diol |
| SMILES | C=CC1(C)C(O)CC[C@@]2(C)C1CCC1(C)C3CCC4(O)CCCC4C3CCC12 |
| InChI | InChI=1S/C26H42O2/c1-5-23(2)21-11-14-24(3)18-10-16-26(28)13-6-7-19(26)17(18)8-9-20(24)25(21,4)15-12-22(23)27/h5,17-22,27-28H,1,6-16H2,2-4H3/t17?,18?,19?,20?,21?,22?,23?,24?,25-,26?/m1/s1 |
| InChIKey | BKTCFYGOKKRWRW-APOLCDQVSA-N |
| XLogP | 5.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|