C25H42O2 — CID 144553370
3-(1-hydroxyethyl)-4,10-dimethyl-4-propyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-13-carbaldehyde (PubChem CID 144553370) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)-4,10-dimethyl-4-propyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-13-carbaldehyde.
| Compound Name | 3-(1-hydroxyethyl)-4,10-dimethyl-4-propyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-13-carbaldehyde |
|---|---|
| PubChem CID | 144553370 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | 3-(1-hydroxyethyl)-4,10-dimethyl-4-propyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-13-carbaldehyde |
| SMILES | CCCC1(C)C(C(C)O)CCC2(C)C3CCC4(C=O)CCCC4C3CCC12 |
| InChI | InChI=1S/C25H42O2/c1-5-12-23(3)19(17(2)27)10-14-24(4)20-11-15-25(16-26)13-6-7-21(25)18(20)8-9-22(23)24/h16-22,27H,5-15H2,1-4H3 |
| InChIKey | DFPCEJUGXKTNMA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|