C24H42O — CID 155751221
7,8,10a-trimethyl-8-(3-methylpentyl)-1,2,3,4,4a,4b,5,6,7,8a,9,10-dodecahydrophenanthrene-1-carbaldehyde (PubChem CID 155751221) has the molecular formula C24H42O and a molecular weight of 346.60 g/mol. Its IUPAC name is 7,8,10a-trimethyl-8-(3-methylpentyl)-1,2,3,4,4a,4b,5,6,7,8a,9,10-dodecahydrophenanthrene-1-carbaldehyde.
| Compound Name | 7,8,10a-trimethyl-8-(3-methylpentyl)-1,2,3,4,4a,4b,5,6,7,8a,9,10-dodecahydrophenanthrene-1-carbaldehyde |
|---|---|
| PubChem CID | 155751221 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | 7,8,10a-trimethyl-8-(3-methylpentyl)-1,2,3,4,4a,4b,5,6,7,8a,9,10-dodecahydrophenanthrene-1-carbaldehyde |
| SMILES | CCC(C)CCC1(C)C(C)CCC2C1CCC1(C)C(C=O)CCCC21 |
| InChI | InChI=1S/C24H42O/c1-6-17(2)12-14-23(4)18(3)10-11-20-21-9-7-8-19(16-25)24(21,5)15-13-22(20)23/h16-22H,6-15H2,1-5H3 |
| InChIKey | BZPFVICZAMMDJW-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|