C25H44 — CID 90729898
8-ethyl-3,3a,6,7-tetramethyl-6-(3-methylpent-4-enyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene (PubChem CID 90729898) has the molecular formula C25H44 and a molecular weight of 344.63 g/mol. Its IUPAC name is 8-ethyl-3,3a,6,7-tetramethyl-6-(3-methylpent-4-enyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene.
| Compound Name | 8-ethyl-3,3a,6,7-tetramethyl-6-(3-methylpent-4-enyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 90729898 |
| Molecular Formula | C25H44 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 344.34 |
| IUPAC Name | 8-ethyl-3,3a,6,7-tetramethyl-6-(3-methylpent-4-enyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene |
| SMILES | C=CC(C)CCC1(C)C(C)C(CC)CC2C3CCC(C)C3(C)CCC21 |
| InChI | InChI=1S/C25H44/c1-8-17(3)12-14-25(7)19(5)20(9-2)16-21-22-11-10-18(4)24(22,6)15-13-23(21)25/h8,17-23H,1,9-16H2,2-7H3 |
| InChIKey | KGCVRROVCFEXRP-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|