C26H44 — CID 155733294
(2S,3R,5R,8R,10R,13R,17R)-5-ethenyl-2-ethyl-3,13-dimethyl-17-propan-2-yl-2,3,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 155733294) has the molecular formula C26H44 and a molecular weight of 356.64 g/mol. Its IUPAC name is (2S,3R,5R,8R,10R,13R,17R)-5-ethenyl-2-ethyl-3,13-dimethyl-17-propan-2-yl-2,3,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (2S,3R,5R,8R,10R,13R,17R)-5-ethenyl-2-ethyl-3,13-dimethyl-17-propan-2-yl-2,3,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 155733294 |
| Molecular Formula | C26H44 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.34 |
| IUPAC Name | (2S,3R,5R,8R,10R,13R,17R)-5-ethenyl-2-ethyl-3,13-dimethyl-17-propan-2-yl-2,3,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C=C[C@]12CC[C@@H]3C(CC[C@@]4(C)C3CC[C@@H]4C(C)C)[C@H]1C[C@H](CC)[C@H](C)C2 |
| InChI | InChI=1S/C26H44/c1-7-19-15-24-21-11-13-25(6)22(17(3)4)9-10-23(25)20(21)12-14-26(24,8-2)16-18(19)5/h8,17-24H,2,7,9-16H2,1,3-6H3/t18-,19+,20-,21?,22-,23?,24-,25-,26-/m1/s1 |
| InChIKey | XCHCGILBCUZPBH-VZSNVIANSA-N |
| XLogP | 7.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|